N-Methylcytisine
Catalog No: FT-0671641
CAS No: 486-86-2
- Chemical Name: N-Methylcytisine
- Molecular Formula: C12H16N2O
- Molecular Weight: 204.27
- InChI Key: CULUKMPMGVXCEI-VHSXEESVSA-N
- InChI: InChI=1S/C12H16N2O/c1-13-6-9-5-10(8-13)11-3-2-4-12(15)14(11)7-9/h2-4,9-10H,5-8H2,1H3/t9-,10+/m0/s1
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 204.268 |
| Density: | 1.2±0.1 g/cm3 |
| CAS: | 486-86-2 |
| Bolling_Point: | 400.8±34.0 °C at 760 mmHg |
| Product_Name: | N-methylcytisine |
| Melting_Point: | 137-139ºC |
| Flash_Point: | 191.9±18.0 °C |
| MF: | C12H16N2O |
| Density: | 1.2±0.1 g/cm3 |
|---|---|
| LogP: | 0.46 |
| Flash_Point: | 191.9±18.0 °C |
| Melting_Point: | 137-139ºC |
| FW: | 204.268 |
| PSA: | 25.24000 |
| Exact_Mass: | 204.126266 |
| MF: | C12H16N2O |
| Bolling_Point: | 400.8±34.0 °C at 760 mmHg |
| Vapor_Pressure: | 0.0±0.9 mmHg at 25°C |
| Refractive_Index: | 1.616 |
| RTECS: | HA4400000 |
|---|---|
| Warning_Statement: | P301 + P312 + P330 |
| Safety_Statements: | H302 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)